About 8-diazo-7,10-dihydroanthracen-1-one
8-diazo-7,10-dihydroanthracen-1-one (PubChem CID 87554697) has the molecular formula C14H10N2O
and a molecular weight of 222.25 g/mol. Its IUPAC name is 8-diazo-7,10-dihydroanthracen-1-one.
Molecular Properties
| Compound Name | 8-diazo-7,10-dihydroanthracen-1-one |
| PubChem CID | 87554697 |
| Molecular Formula | C14H10N2O |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 8-diazo-7,10-dihydroanthracen-1-one |
| SMILES | [N-]=[N+]=C1CC=CC2=C1C=C1C(=O)C=CC=C1C2 |
| InChI | InChI=1S/C14H10N2O/c15-16-13-5-1-3-9-7-10-4-2-6-14(17)12(10)8-11(9)13/h1-4,6,8H,5,7H2 |
| InChIKey | LZTVZVODUVINKE-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 8-diazo-7,10-dihydroanthracen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-diazo-7,10-dihydroanthracen-1-one?
The IUPAC name of 8-diazo-7,10-dihydroanthracen-1-one (CID 87554697) is 8-diazo-7,10-dihydroanthracen-1-one.
What is the SMILES notation for 8-diazo-7,10-dihydroanthracen-1-one?
The canonical SMILES for 8-diazo-7,10-dihydroanthracen-1-one is [N-]=[N+]=C1CC=CC2=C1C=C1C(=O)C=CC=C1C2.
What is the InChIKey of 8-diazo-7,10-dihydroanthracen-1-one?
The InChIKey is LZTVZVODUVINKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2O/c15-16-13-5-1-3-9-7-10-4-2-6-14(17)12(10)8-11(9)13/h1-4,6,8H,5,7H2.
What are the key properties of 8-diazo-7,10-dihydroanthracen-1-one?
8-diazo-7,10-dihydroanthracen-1-one has a molecular weight of 222.25 g/mol, XLogP of 2.31, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-diazo-7,10-dihydroanthracen-1-one is sourced from PubChem (CID 87554697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).