About 2-methyl-N-propa-1,2-dienylprop-2-enamide
2-methyl-N-propa-1,2-dienylprop-2-enamide (PubChem CID 87554881) has the molecular formula C7H9NO
and a molecular weight of 123.15 g/mol. Its IUPAC name is 2-methyl-N-propa-1,2-dienylprop-2-enamide.
Molecular Properties
| Compound Name | 2-methyl-N-propa-1,2-dienylprop-2-enamide |
| PubChem CID | 87554881 |
| Molecular Formula | C7H9NO |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.07 |
| IUPAC Name | 2-methyl-N-propa-1,2-dienylprop-2-enamide |
| SMILES | C=C=CNC(=O)C(=C)C |
| InChI | InChI=1S/C7H9NO/c1-4-5-8-7(9)6(2)3/h5H,1-2H2,3H3,(H,8,9) |
| InChIKey | QTVVNQPUNWZISE-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N-propa-1,2-dienylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-propa-1,2-dienylprop-2-enamide?
The IUPAC name of 2-methyl-N-propa-1,2-dienylprop-2-enamide (CID 87554881) is 2-methyl-N-propa-1,2-dienylprop-2-enamide.
What is the SMILES notation for 2-methyl-N-propa-1,2-dienylprop-2-enamide?
The canonical SMILES for 2-methyl-N-propa-1,2-dienylprop-2-enamide is C=C=CNC(=O)C(=C)C.
What is the InChIKey of 2-methyl-N-propa-1,2-dienylprop-2-enamide?
The InChIKey is QTVVNQPUNWZISE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO/c1-4-5-8-7(9)6(2)3/h5H,1-2H2,3H3,(H,8,9).
What are the key properties of 2-methyl-N-propa-1,2-dienylprop-2-enamide?
2-methyl-N-propa-1,2-dienylprop-2-enamide has a molecular weight of 123.15 g/mol, XLogP of 0.98, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-propa-1,2-dienylprop-2-enamide is sourced from PubChem (CID 87554881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).