About N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)quinazolin-4-amine
N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)quinazolin-4-amine (PubChem CID 87555137) has the molecular formula C44H46N6O8
and a molecular weight of 786.89 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)quinazolin-4-amine.
Molecular Properties
| Compound Name | N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)quinazolin-4-amine |
| PubChem CID | 87555137 |
| Molecular Formula | C44H46N6O8 |
| Molecular Weight | 786.89 g/mol |
| Exact Mass | 786.34 |
| IUPAC Name | N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)quinazolin-4-amine |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OCCOC)c(OCCOC)cc23)c1.C#Cc1cccc(Nc2ncnc3cc(OCCOC)c(OCCOC)cc23)c1 |
| InChI | InChI=1S/2C22H23N3O4/c2*1-4-16-6-5-7-17(12-16)25-22-18-13-20(28-10-8-26-2)21(29-11-9-27-3)14-19(18)23-15-24-22/h2*1,5-7,12-15H,8-11H2,2-3H3,(H,23,24,25) |
| InChIKey | OUMBWGOOVKEVKS-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 149.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 58 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 786.89 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)quinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)quinazolin-4-amine?
The IUPAC name of N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)quinazolin-4-amine (CID 87555137) is N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)quinazolin-4-amine.
What is the SMILES notation for N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)quinazolin-4-amine?
The canonical SMILES for N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)quinazolin-4-amine is C#Cc1cccc(Nc2ncnc3cc(OCCOC)c(OCCOC)cc23)c1.C#Cc1cccc(Nc2ncnc3cc(OCCOC)c(OCCOC)cc23)c1.
What is the InChIKey of N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)quinazolin-4-amine?
The InChIKey is OUMBWGOOVKEVKS-UHFFFAOYSA-N. The full InChI is InChI=1S/2C22H23N3O4/c2*1-4-16-6-5-7-17(12-16)25-22-18-13-20(28-10-8-26-2)21(29-11-9-27-3)14-19(18)23-15-24-22/h2*1,5-7,12-15H,8-11H2,2-3H3,(H,23,24,25).
What are the key properties of N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)quinazolin-4-amine?
N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)quinazolin-4-amine has a molecular weight of 786.89 g/mol, XLogP of 6.81, 20 rotatable bonds, 2 hydrogen bond donors, and 14 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)quinazolin-4-amine is sourced from PubChem (CID 87555137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).