C37H24F4N2O4 — CID 87555286
3-benzyl-6,7-difluoro-3-(4-hydroxyphenyl)-1H-indol-2-one;3-ethynyl-6,7-difluoro-3-(4-hydroxyphenyl)-1H-indol-2-one (PubChem CID 87555286) has the molecular formula C37H24F4N2O4 and a molecular weight of 636.60 g/mol. Its IUPAC name is 3-benzyl-6,7-difluoro-3-(4-hydroxyphenyl)-1H-indol-2-one;3-ethynyl-6,7-difluoro-3-(4-hydroxyphenyl)-1H-indol-2-one.
| Compound Name | 3-benzyl-6,7-difluoro-3-(4-hydroxyphenyl)-1H-indol-2-one;3-ethynyl-6,7-difluoro-3-(4-hydroxyphenyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 87555286 |
| Molecular Formula | C37H24F4N2O4 |
| Molecular Weight | 636.60 g/mol |
| Exact Mass | 636.17 |
| IUPAC Name | 3-benzyl-6,7-difluoro-3-(4-hydroxyphenyl)-1H-indol-2-one;3-ethynyl-6,7-difluoro-3-(4-hydroxyphenyl)-1H-indol-2-one |
| SMILES | C#CC1(c2ccc(O)cc2)C(=O)Nc2c1ccc(F)c2F.O=C1Nc2c(ccc(F)c2F)C1(Cc1ccccc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C21H15F2NO2.C16H9F2NO2/c22-17-11-10-16-19(18(17)23)24-20(26)21(16,12-13-4-2-1-3-5-13)14-6-8-15(25)9-7-14;1-2-16(9-3-5-10(20)6-4-9)11-7-8-12(17)13(18)14(11)19-15(16)21/h1-11,25H,12H2,(H,24,26);1,3-8,20H,(H,19,21) |
| InChIKey | FYXGXDPRIYOVTQ-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.60 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|