C26H25N2S2+ — CID 87555505
2-[7-(3H-1,3-benzothiazol-2-ylidene)hepta-1,3,5-trienyl]-10,10-dimethyl-3-thia-1-azoniatricyclo[6.3.1.04,12]dodeca-1,4,6,8(12)-tetraene (PubChem CID 87555505) has the molecular formula C26H25N2S2+ and a molecular weight of 429.63 g/mol. Its IUPAC name is 2-[7-(3H-1,3-benzothiazol-2-ylidene)hepta-1,3,5-trienyl]-10,10-dimethyl-3-thia-1-azoniatricyclo[6.3.1.04,12]dodeca-1,4,6,8(12)-tetraene.
| Compound Name | 2-[7-(3H-1,3-benzothiazol-2-ylidene)hepta-1,3,5-trienyl]-10,10-dimethyl-3-thia-1-azoniatricyclo[6.3.1.04,12]dodeca-1,4,6,8(12)-tetraene |
|---|---|
| PubChem CID | 87555505 |
| Molecular Formula | C26H25N2S2+ |
| Molecular Weight | 429.63 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | 2-[7-(3H-1,3-benzothiazol-2-ylidene)hepta-1,3,5-trienyl]-10,10-dimethyl-3-thia-1-azoniatricyclo[6.3.1.04,12]dodeca-1,4,6,8(12)-tetraene |
| SMILES | CC1(C)Cc2cccc3sc(C=CC=CC=CC=C4Nc5ccccc5S4)[n+](c23)C1 |
| InChI | InChI=1S/C26H24N2S2/c1-26(2)17-19-11-10-14-22-25(19)28(18-26)24(30-22)16-7-5-3-4-6-15-23-27-20-12-8-9-13-21(20)29-23/h3-16H,17-18H2,1-2H3/p+1 |
| InChIKey | FCUDBIKYUOJADE-UHFFFAOYSA-O |
| XLogP | 6.96 |
| TPSA | 15.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.63 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|