About 5-[(5-amino-4-iodo-2,3-dipropylphenyl)methyl]-2-iodo-3,4-dipropylaniline
5-[(5-amino-4-iodo-2,3-dipropylphenyl)methyl]-2-iodo-3,4-dipropylaniline (PubChem CID 87555717) has the molecular formula C25H36I2N2
and a molecular weight of 618.39 g/mol. Its IUPAC name is 5-[(5-amino-4-iodo-2,3-dipropylphenyl)methyl]-2-iodo-3,4-dipropylaniline.
Molecular Properties
| Compound Name | 5-[(5-amino-4-iodo-2,3-dipropylphenyl)methyl]-2-iodo-3,4-dipropylaniline |
| PubChem CID | 87555717 |
| Molecular Formula | C25H36I2N2 |
| Molecular Weight | 618.39 g/mol |
| Exact Mass | 618.10 |
| IUPAC Name | 5-[(5-amino-4-iodo-2,3-dipropylphenyl)methyl]-2-iodo-3,4-dipropylaniline |
| SMILES | CCCc1c(Cc2cc(N)c(I)c(CCC)c2CCC)cc(N)c(I)c1CCC |
| InChI | InChI=1S/C25H36I2N2/c1-5-9-18-16(14-22(28)24(26)20(18)11-7-3)13-17-15-23(29)25(27)21(12-8-4)19(17)10-6-2/h14-15H,5-13,28-29H2,1-4H3 |
| InChIKey | NFDYKBUAWFBFKQ-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 618.39 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-[(5-amino-4-iodo-2,3-dipropylphenyl)methyl]-2-iodo-3,4-dipropylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(5-amino-4-iodo-2,3-dipropylphenyl)methyl]-2-iodo-3,4-dipropylaniline?
The IUPAC name of 5-[(5-amino-4-iodo-2,3-dipropylphenyl)methyl]-2-iodo-3,4-dipropylaniline (CID 87555717) is 5-[(5-amino-4-iodo-2,3-dipropylphenyl)methyl]-2-iodo-3,4-dipropylaniline.
What is the SMILES notation for 5-[(5-amino-4-iodo-2,3-dipropylphenyl)methyl]-2-iodo-3,4-dipropylaniline?
The canonical SMILES for 5-[(5-amino-4-iodo-2,3-dipropylphenyl)methyl]-2-iodo-3,4-dipropylaniline is CCCc1c(Cc2cc(N)c(I)c(CCC)c2CCC)cc(N)c(I)c1CCC.
What is the InChIKey of 5-[(5-amino-4-iodo-2,3-dipropylphenyl)methyl]-2-iodo-3,4-dipropylaniline?
The InChIKey is NFDYKBUAWFBFKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H36I2N2/c1-5-9-18-16(14-22(28)24(26)20(18)11-7-3)13-17-15-23(29)25(27)21(12-8-4)19(17)10-6-2/h14-15H,5-13,28-29H2,1-4H3.
What are the key properties of 5-[(5-amino-4-iodo-2,3-dipropylphenyl)methyl]-2-iodo-3,4-dipropylaniline?
5-[(5-amino-4-iodo-2,3-dipropylphenyl)methyl]-2-iodo-3,4-dipropylaniline has a molecular weight of 618.39 g/mol, XLogP of 7.46, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(5-amino-4-iodo-2,3-dipropylphenyl)methyl]-2-iodo-3,4-dipropylaniline is sourced from PubChem (CID 87555717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).