C9HF15O4 — CID 87555833
2-[difluoro-[1,1,1,2,3,3-hexafluoro-3-(1,2,2-trifluoroethenoxy)propan-2-yl]oxymethyl]-2,3,3,3-tetrafluoropropanoic acid (PubChem CID 87555833) has the molecular formula C9HF15O4 and a molecular weight of 458.07 g/mol. Its IUPAC name is 2-[difluoro-[1,1,1,2,3,3-hexafluoro-3-(1,2,2-trifluoroethenoxy)propan-2-yl]oxymethyl]-2,3,3,3-tetrafluoropropanoic acid.
| Compound Name | 2-[difluoro-[1,1,1,2,3,3-hexafluoro-3-(1,2,2-trifluoroethenoxy)propan-2-yl]oxymethyl]-2,3,3,3-tetrafluoropropanoic acid |
|---|---|
| PubChem CID | 87555833 |
| Molecular Formula | C9HF15O4 |
| Molecular Weight | 458.07 g/mol |
| Exact Mass | 457.96 |
| IUPAC Name | 2-[difluoro-[1,1,1,2,3,3-hexafluoro-3-(1,2,2-trifluoroethenoxy)propan-2-yl]oxymethyl]-2,3,3,3-tetrafluoropropanoic acid |
| SMILES | O=C(O)C(F)(C(F)(F)F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OC(F)=C(F)F |
| InChI | InChI=1S/C9HF15O4/c10-1(11)2(12)27-9(23,24)5(14,7(18,19)20)28-8(21,22)4(13,3(25)26)6(15,16)17/h(H,25,26) |
| InChIKey | IONHGLKQPRBYQK-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.07 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|