C22H28ClN5O2 — CID 87555935
6-[4-(2-chloropyridine-3-carbonyl)piperazin-1-yl]-N-(4-methylpentan-2-yl)pyridine-3-carboxamide (PubChem CID 87555935) has the molecular formula C22H28ClN5O2 and a molecular weight of 429.95 g/mol. Its IUPAC name is 6-[4-(2-chloropyridine-3-carbonyl)piperazin-1-yl]-N-(4-methylpentan-2-yl)pyridine-3-carboxamide.
| Compound Name | 6-[4-(2-chloropyridine-3-carbonyl)piperazin-1-yl]-N-(4-methylpentan-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 87555935 |
| Molecular Formula | C22H28ClN5O2 |
| Molecular Weight | 429.95 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 6-[4-(2-chloropyridine-3-carbonyl)piperazin-1-yl]-N-(4-methylpentan-2-yl)pyridine-3-carboxamide |
| SMILES | CC(C)CC(C)NC(=O)c1ccc(N2CCN(C(=O)c3cccnc3Cl)CC2)nc1 |
| InChI | InChI=1S/C22H28ClN5O2/c1-15(2)13-16(3)26-21(29)17-6-7-19(25-14-17)27-9-11-28(12-10-27)22(30)18-5-4-8-24-20(18)23/h4-8,14-16H,9-13H2,1-3H3,(H,26,29) |
| InChIKey | SYUKLPGIHYSMIG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.95 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|