C12H18N4O4S — CID 87556394
6-ethyl-9-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-sulfanyloxolan-2-yl]-8H-purin-6-ol (PubChem CID 87556394) has the molecular formula C12H18N4O4S and a molecular weight of 314.37 g/mol. Its IUPAC name is 6-ethyl-9-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-sulfanyloxolan-2-yl]-8H-purin-6-ol.
| Compound Name | 6-ethyl-9-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-sulfanyloxolan-2-yl]-8H-purin-6-ol |
|---|---|
| PubChem CID | 87556394 |
| Molecular Formula | C12H18N4O4S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 6-ethyl-9-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-sulfanyloxolan-2-yl]-8H-purin-6-ol |
| SMILES | CCC1(O)N=CN=C2C1=NCN2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1S |
| InChI | InChI=1S/C12H18N4O4S/c1-2-12(19)9-10(13-4-15-12)16(5-14-9)11-8(21)7(18)6(3-17)20-11/h4,6-8,11,17-19,21H,2-3,5H2,1H3/t6-,7-,8-,11-,12?/m1/s1 |
| InChIKey | VRDHPRZGZXZCIP-XRDACOTDSA-N |
| XLogP | -1.38 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|