About 1,2,5-triisocyanato-3,4-dimethylbenzene
1,2,5-triisocyanato-3,4-dimethylbenzene (PubChem CID 87556627) has the molecular formula C11H7N3O3
and a molecular weight of 229.19 g/mol. Its IUPAC name is 1,2,5-triisocyanato-3,4-dimethylbenzene.
Molecular Properties
| Compound Name | 1,2,5-triisocyanato-3,4-dimethylbenzene |
| PubChem CID | 87556627 |
| Molecular Formula | C11H7N3O3 |
| Molecular Weight | 229.19 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 1,2,5-triisocyanato-3,4-dimethylbenzene |
| SMILES | Cc1c(N=C=O)cc(N=C=O)c(N=C=O)c1C |
| InChI | InChI=1S/C11H7N3O3/c1-7-8(2)11(14-6-17)10(13-5-16)3-9(7)12-4-15/h3H,1-2H3 |
| InChIKey | IQNGNYIKNMWGGH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 88.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.19 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1,2,5-triisocyanato-3,4-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,5-triisocyanato-3,4-dimethylbenzene?
The IUPAC name of 1,2,5-triisocyanato-3,4-dimethylbenzene (CID 87556627) is 1,2,5-triisocyanato-3,4-dimethylbenzene.
What is the SMILES notation for 1,2,5-triisocyanato-3,4-dimethylbenzene?
The canonical SMILES for 1,2,5-triisocyanato-3,4-dimethylbenzene is Cc1c(N=C=O)cc(N=C=O)c(N=C=O)c1C.
What is the InChIKey of 1,2,5-triisocyanato-3,4-dimethylbenzene?
The InChIKey is IQNGNYIKNMWGGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N3O3/c1-7-8(2)11(14-6-17)10(13-5-16)3-9(7)12-4-15/h3H,1-2H3.
What are the key properties of 1,2,5-triisocyanato-3,4-dimethylbenzene?
1,2,5-triisocyanato-3,4-dimethylbenzene has a molecular weight of 229.19 g/mol, XLogP of 2.21, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,5-triisocyanato-3,4-dimethylbenzene is sourced from PubChem (CID 87556627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).