About (6-aminocyclohexa-2,4-dien-1-ylidene)methanone
(6-aminocyclohexa-2,4-dien-1-ylidene)methanone (PubChem CID 87556812) has the molecular formula C7H7NO
and a molecular weight of 121.14 g/mol. Its IUPAC name is (6-aminocyclohexa-2,4-dien-1-ylidene)methanone.
Molecular Properties
| Compound Name | (6-aminocyclohexa-2,4-dien-1-ylidene)methanone |
| PubChem CID | 87556812 |
| Molecular Formula | C7H7NO |
| Molecular Weight | 121.14 g/mol |
| Exact Mass | 121.05 |
| IUPAC Name | (6-aminocyclohexa-2,4-dien-1-ylidene)methanone |
| SMILES | NC1C=CC=CC1=C=O |
| InChI | InChI=1S/C7H7NO/c8-7-4-2-1-3-6(7)5-9/h1-4,7H,8H2 |
| InChIKey | OMHYZSGNUMNNAK-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.14 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze (6-aminocyclohexa-2,4-dien-1-ylidene)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-aminocyclohexa-2,4-dien-1-ylidene)methanone?
The IUPAC name of (6-aminocyclohexa-2,4-dien-1-ylidene)methanone (CID 87556812) is (6-aminocyclohexa-2,4-dien-1-ylidene)methanone.
What is the SMILES notation for (6-aminocyclohexa-2,4-dien-1-ylidene)methanone?
The canonical SMILES for (6-aminocyclohexa-2,4-dien-1-ylidene)methanone is NC1C=CC=CC1=C=O.
What is the InChIKey of (6-aminocyclohexa-2,4-dien-1-ylidene)methanone?
The InChIKey is OMHYZSGNUMNNAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO/c8-7-4-2-1-3-6(7)5-9/h1-4,7H,8H2.
What are the key properties of (6-aminocyclohexa-2,4-dien-1-ylidene)methanone?
(6-aminocyclohexa-2,4-dien-1-ylidene)methanone has a molecular weight of 121.14 g/mol, XLogP of 0.20, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6-aminocyclohexa-2,4-dien-1-ylidene)methanone is sourced from PubChem (CID 87556812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).