C30H34Cl2N2ORuS — CID 87557363
[1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]-dichloro-[[2-(2-sulfanylideneethoxy)phenyl]methylidene]ruthenium (PubChem CID 87557363) has the molecular formula C30H34Cl2N2ORuS and a molecular weight of 642.66 g/mol. Its IUPAC name is [1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]-dichloro-[[2-(2-sulfanylideneethoxy)phenyl]methylidene]ruthenium.
| Compound Name | [1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]-dichloro-[[2-(2-sulfanylideneethoxy)phenyl]methylidene]ruthenium |
|---|---|
| PubChem CID | 87557363 |
| Molecular Formula | C30H34Cl2N2ORuS |
| Molecular Weight | 642.66 g/mol |
| Exact Mass | 642.08 |
| IUPAC Name | [1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]-dichloro-[[2-(2-sulfanylideneethoxy)phenyl]methylidene]ruthenium |
| SMILES | Cc1cc(C)c(N2CCN(c3c(C)cc(C)cc3C)C2=[Ru](Cl)(Cl)=Cc2ccccc2OCC=S)c(C)c1 |
| InChI | InChI=1S/C21H26N2.C9H8OS.2ClH.Ru/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6;1-8-4-2-3-5-9(8)10-6-7-11;;;/h9-12H,7-8H2,1-6H3;1-5,7H,6H2;2*1H;/q;;;;+2/p-2 |
| InChIKey | PNCBEWWDBDKTKO-UHFFFAOYSA-L |
| XLogP | 7.64 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.66 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|