About 2-methylcyclohexane-1,1-dicarbonyl chloride
2-methylcyclohexane-1,1-dicarbonyl chloride (PubChem CID 87557674) has the molecular formula C9H12Cl2O2
and a molecular weight of 223.10 g/mol. Its IUPAC name is 2-methylcyclohexane-1,1-dicarbonyl chloride.
Molecular Properties
| Compound Name | 2-methylcyclohexane-1,1-dicarbonyl chloride |
| PubChem CID | 87557674 |
| Molecular Formula | C9H12Cl2O2 |
| Molecular Weight | 223.10 g/mol |
| Exact Mass | 222.02 |
| IUPAC Name | 2-methylcyclohexane-1,1-dicarbonyl chloride |
| SMILES | CC1CCCCC1(C(=O)Cl)C(=O)Cl |
| InChI | InChI=1S/C9H12Cl2O2/c1-6-4-2-3-5-9(6,7(10)12)8(11)13/h6H,2-5H2,1H3 |
| InChIKey | AWDDWMRAIJYDEO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.10 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-methylcyclohexane-1,1-dicarbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylcyclohexane-1,1-dicarbonyl chloride?
The IUPAC name of 2-methylcyclohexane-1,1-dicarbonyl chloride (CID 87557674) is 2-methylcyclohexane-1,1-dicarbonyl chloride.
What is the SMILES notation for 2-methylcyclohexane-1,1-dicarbonyl chloride?
The canonical SMILES for 2-methylcyclohexane-1,1-dicarbonyl chloride is CC1CCCCC1(C(=O)Cl)C(=O)Cl.
What is the InChIKey of 2-methylcyclohexane-1,1-dicarbonyl chloride?
The InChIKey is AWDDWMRAIJYDEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12Cl2O2/c1-6-4-2-3-5-9(6,7(10)12)8(11)13/h6H,2-5H2,1H3.
What are the key properties of 2-methylcyclohexane-1,1-dicarbonyl chloride?
2-methylcyclohexane-1,1-dicarbonyl chloride has a molecular weight of 223.10 g/mol, XLogP of 2.71, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylcyclohexane-1,1-dicarbonyl chloride is sourced from PubChem (CID 87557674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).