C9H11F9O3S — CID 87558447
3-(3,3,4,4,5,5,6,6,6-nonafluorohexan-2-ylsulfonyl)propan-1-ol (PubChem CID 87558447) has the molecular formula C9H11F9O3S and a molecular weight of 370.23 g/mol. Its IUPAC name is 3-(3,3,4,4,5,5,6,6,6-nonafluorohexan-2-ylsulfonyl)propan-1-ol.
| Compound Name | 3-(3,3,4,4,5,5,6,6,6-nonafluorohexan-2-ylsulfonyl)propan-1-ol |
|---|---|
| PubChem CID | 87558447 |
| Molecular Formula | C9H11F9O3S |
| Molecular Weight | 370.23 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | 3-(3,3,4,4,5,5,6,6,6-nonafluorohexan-2-ylsulfonyl)propan-1-ol |
| SMILES | CC(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)S(=O)(=O)CCCO |
| InChI | InChI=1S/C9H11F9O3S/c1-5(22(20,21)4-2-3-19)6(10,11)7(12,13)8(14,15)9(16,17)18/h5,19H,2-4H2,1H3 |
| InChIKey | APROFZNHMJRDCA-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.23 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|