About 2-bromo-N-carbamoyl-2-ethylbutanamide;(E)-3-methylpent-2-ene
2-bromo-N-carbamoyl-2-ethylbutanamide;(E)-3-methylpent-2-ene (PubChem CID 87558458) has the molecular formula C13H25BrN2O2
and a molecular weight of 321.26 g/mol. Its IUPAC name is 2-bromo-N-carbamoyl-2-ethylbutanamide;(E)-3-methylpent-2-ene.
Molecular Properties
| Compound Name | 2-bromo-N-carbamoyl-2-ethylbutanamide;(E)-3-methylpent-2-ene |
| PubChem CID | 87558458 |
| Molecular Formula | C13H25BrN2O2 |
| Molecular Weight | 321.26 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 2-bromo-N-carbamoyl-2-ethylbutanamide;(E)-3-methylpent-2-ene |
| SMILES | C/C=C(\C)CC.CCC(Br)(CC)C(=O)NC(N)=O |
| InChI | InChI=1S/C7H13BrN2O2.C6H12/c1-3-7(8,4-2)5(11)10-6(9)12;1-4-6(3)5-2/h3-4H2,1-2H3,(H3,9,10,11,12);4H,5H2,1-3H3/b;6-4+ |
| InChIKey | TXQGGMPBXGSICI-DVXCEAISSA-N |
| XLogP | 3.50 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.26 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-N-carbamoyl-2-ethylbutanamide;(E)-3-methylpent-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N-carbamoyl-2-ethylbutanamide;(E)-3-methylpent-2-ene?
The IUPAC name of 2-bromo-N-carbamoyl-2-ethylbutanamide;(E)-3-methylpent-2-ene (CID 87558458) is 2-bromo-N-carbamoyl-2-ethylbutanamide;(E)-3-methylpent-2-ene.
What is the SMILES notation for 2-bromo-N-carbamoyl-2-ethylbutanamide;(E)-3-methylpent-2-ene?
The canonical SMILES for 2-bromo-N-carbamoyl-2-ethylbutanamide;(E)-3-methylpent-2-ene is C/C=C(\C)CC.CCC(Br)(CC)C(=O)NC(N)=O.
What is the InChIKey of 2-bromo-N-carbamoyl-2-ethylbutanamide;(E)-3-methylpent-2-ene?
The InChIKey is TXQGGMPBXGSICI-DVXCEAISSA-N. The full InChI is InChI=1S/C7H13BrN2O2.C6H12/c1-3-7(8,4-2)5(11)10-6(9)12;1-4-6(3)5-2/h3-4H2,1-2H3,(H3,9,10,11,12);4H,5H2,1-3H3/b;6-4+.
What are the key properties of 2-bromo-N-carbamoyl-2-ethylbutanamide;(E)-3-methylpent-2-ene?
2-bromo-N-carbamoyl-2-ethylbutanamide;(E)-3-methylpent-2-ene has a molecular weight of 321.26 g/mol, XLogP of 3.50, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N-carbamoyl-2-ethylbutanamide;(E)-3-methylpent-2-ene is sourced from PubChem (CID 87558458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).