C8H16N2O5 — CID 87558504
tert-butyl N-[(2R)-3-hydroxy-1-(hydroxyamino)-1-oxopropan-2-yl]carbamate (PubChem CID 87558504) has the molecular formula C8H16N2O5 and a molecular weight of 220.22 g/mol. Its IUPAC name is tert-butyl N-[(2R)-3-hydroxy-1-(hydroxyamino)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-3-hydroxy-1-(hydroxyamino)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 87558504 |
| Molecular Formula | C8H16N2O5 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | tert-butyl N-[(2R)-3-hydroxy-1-(hydroxyamino)-1-oxopropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CO)C(=O)NO |
| InChI | InChI=1S/C8H16N2O5/c1-8(2,3)15-7(13)9-5(4-11)6(12)10-14/h5,11,14H,4H2,1-3H3,(H,9,13)(H,10,12)/t5-/m1/s1 |
| InChIKey | HHOZCWHXDLNJAX-RXMQYKEDSA-N |
| XLogP | -0.62 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|