C14H16N2O6 — CID 87558954
(2,5-dioxopyrrolidin-1-yl) 5-(morpholin-4-ylmethyl)furan-2-carboxylate (PubChem CID 87558954) has the molecular formula C14H16N2O6 and a molecular weight of 308.29 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 5-(morpholin-4-ylmethyl)furan-2-carboxylate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 5-(morpholin-4-ylmethyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 87558954 |
| Molecular Formula | C14H16N2O6 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 5-(morpholin-4-ylmethyl)furan-2-carboxylate |
| SMILES | O=C(ON1C(=O)CCC1=O)c1ccc(CN2CCOCC2)o1 |
| InChI | InChI=1S/C14H16N2O6/c17-12-3-4-13(18)16(12)22-14(19)11-2-1-10(21-11)9-15-5-7-20-8-6-15/h1-2H,3-9H2 |
| InChIKey | DXWHPKJFHSKPSU-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 89.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|