About 1,2-dimethylcyclopenta-1,3-diene;zirconium;dihydrochloride
1,2-dimethylcyclopenta-1,3-diene;zirconium;dihydrochloride (PubChem CID 87558961) has the molecular formula C7H11Cl2Zr-
and a molecular weight of 257.29 g/mol. Its IUPAC name is 1,2-dimethylcyclopenta-1,3-diene;zirconium;dihydrochloride.
Molecular Properties
| Compound Name | 1,2-dimethylcyclopenta-1,3-diene;zirconium;dihydrochloride |
| PubChem CID | 87558961 |
| Molecular Formula | C7H11Cl2Zr- |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 254.93 |
| IUPAC Name | 1,2-dimethylcyclopenta-1,3-diene;zirconium;dihydrochloride |
| SMILES | CC1=C(C)C[C-]=C1.Cl.Cl.[Zr] |
| InChI | InChI=1S/C7H9.2ClH.Zr/c1-6-4-3-5-7(6)2;;;/h4H,5H2,1-2H3;2*1H;/q-1;;; |
| InChIKey | GXIACYAVKMWQFD-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dimethylcyclopenta-1,3-diene;zirconium;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethylcyclopenta-1,3-diene;zirconium;dihydrochloride?
The IUPAC name of 1,2-dimethylcyclopenta-1,3-diene;zirconium;dihydrochloride (CID 87558961) is 1,2-dimethylcyclopenta-1,3-diene;zirconium;dihydrochloride.
What is the SMILES notation for 1,2-dimethylcyclopenta-1,3-diene;zirconium;dihydrochloride?
The canonical SMILES for 1,2-dimethylcyclopenta-1,3-diene;zirconium;dihydrochloride is CC1=C(C)C[C-]=C1.Cl.Cl.[Zr].
What is the InChIKey of 1,2-dimethylcyclopenta-1,3-diene;zirconium;dihydrochloride?
The InChIKey is GXIACYAVKMWQFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9.2ClH.Zr/c1-6-4-3-5-7(6)2;;;/h4H,5H2,1-2H3;2*1H;/q-1;;;.
What are the key properties of 1,2-dimethylcyclopenta-1,3-diene;zirconium;dihydrochloride?
1,2-dimethylcyclopenta-1,3-diene;zirconium;dihydrochloride has a molecular weight of 257.29 g/mol, XLogP of 2.93, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethylcyclopenta-1,3-diene;zirconium;dihydrochloride is sourced from PubChem (CID 87558961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).