C26H44O6S — CID 87558983
[(3R,4R,5R)-4-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-6-hydroxy-5-methylhexan-3-yl] 4-methylbenzenesulfonate (PubChem CID 87558983) has the molecular formula C26H44O6S and a molecular weight of 484.70 g/mol. Its IUPAC name is [(3R,4R,5R)-4-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-6-hydroxy-5-methylhexan-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [(3R,4R,5R)-4-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-6-hydroxy-5-methylhexan-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87558983 |
| Molecular Formula | C26H44O6S |
| Molecular Weight | 484.70 g/mol |
| Exact Mass | 484.29 |
| IUPAC Name | [(3R,4R,5R)-4-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-6-hydroxy-5-methylhexan-3-yl] 4-methylbenzenesulfonate |
| SMILES | CCCCCCCC1(CC[C@H]([C@@H](C)CO)[C@@H](CC)OS(=O)(=O)c2ccc(C)cc2)OCCO1 |
| InChI | InChI=1S/C26H44O6S/c1-5-7-8-9-10-16-26(30-18-19-31-26)17-15-24(22(4)20-27)25(6-2)32-33(28,29)23-13-11-21(3)12-14-23/h11-14,22,24-25,27H,5-10,15-20H2,1-4H3/t22-,24+,25+/m0/s1 |
| InChIKey | KGGNCNBIXSLRFX-ICDZXHCJSA-N |
| XLogP | 5.61 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.70 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|