About 2,9-dimethyldecane-3,8-diamine
2,9-dimethyldecane-3,8-diamine (PubChem CID 87559181) has the molecular formula C12H28N2
and a molecular weight of 200.37 g/mol. Its IUPAC name is 2,9-dimethyldecane-3,8-diamine.
Molecular Properties
| Compound Name | 2,9-dimethyldecane-3,8-diamine |
| PubChem CID | 87559181 |
| Molecular Formula | C12H28N2 |
| Molecular Weight | 200.37 g/mol |
| Exact Mass | 200.23 |
| IUPAC Name | 2,9-dimethyldecane-3,8-diamine |
| SMILES | CC(C)C(N)CCCCC(N)C(C)C |
| InChI | InChI=1S/C12H28N2/c1-9(2)11(13)7-5-6-8-12(14)10(3)4/h9-12H,5-8,13-14H2,1-4H3 |
| InChIKey | JAQTZULVKVYACR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,9-dimethyldecane-3,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,9-dimethyldecane-3,8-diamine?
The IUPAC name of 2,9-dimethyldecane-3,8-diamine (CID 87559181) is 2,9-dimethyldecane-3,8-diamine.
What is the SMILES notation for 2,9-dimethyldecane-3,8-diamine?
The canonical SMILES for 2,9-dimethyldecane-3,8-diamine is CC(C)C(N)CCCCC(N)C(C)C.
What is the InChIKey of 2,9-dimethyldecane-3,8-diamine?
The InChIKey is JAQTZULVKVYACR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H28N2/c1-9(2)11(13)7-5-6-8-12(14)10(3)4/h9-12H,5-8,13-14H2,1-4H3.
What are the key properties of 2,9-dimethyldecane-3,8-diamine?
2,9-dimethyldecane-3,8-diamine has a molecular weight of 200.37 g/mol, XLogP of 2.51, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,9-dimethyldecane-3,8-diamine is sourced from PubChem (CID 87559181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).