C30H10B2F15O3- — CID 87559514
[4-(4-boronooxyphenyl)phenyl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 87559514) has the molecular formula C30H10B2F15O3- and a molecular weight of 725.00 g/mol. Its IUPAC name is [4-(4-boronooxyphenyl)phenyl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | [4-(4-boronooxyphenyl)phenyl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 87559514 |
| Molecular Formula | C30H10B2F15O3- |
| Molecular Weight | 725.00 g/mol |
| Exact Mass | 725.06 |
| IUPAC Name | [4-(4-boronooxyphenyl)phenyl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | OB(O)Oc1ccc(-c2ccc([B-](c3c(F)c(F)c(F)c(F)c3F)(c3c(F)c(F)c(F)c(F)c3F)c3c(F)c(F)c(F)c(F)c3F)cc2)cc1 |
| InChI | InChI=1S/C30H10B2F15O3/c33-16-13(17(34)23(40)28(45)22(16)39)32(14-18(35)24(41)29(46)25(42)19(14)36,15-20(37)26(43)30(47)27(44)21(15)38)11-5-1-9(2-6-11)10-3-7-12(8-4-10)50-31(48)49/h1-8,48-49H/q-1 |
| InChIKey | XKBOMVZQXXQHKU-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.00 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|