About dibutyl (Z)-2,3-dibutylbut-2-enedioate
dibutyl (Z)-2,3-dibutylbut-2-enedioate (PubChem CID 87559557) has the molecular formula C20H36O4
and a molecular weight of 340.50 g/mol. Its IUPAC name is dibutyl (Z)-2,3-dibutylbut-2-enedioate.
Molecular Properties
| Compound Name | dibutyl (Z)-2,3-dibutylbut-2-enedioate |
| PubChem CID | 87559557 |
| Molecular Formula | C20H36O4 |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | dibutyl (Z)-2,3-dibutylbut-2-enedioate |
| SMILES | CCCCOC(=O)/C(CCCC)=C(/CCCC)C(=O)OCCCC |
| InChI | InChI=1S/C20H36O4/c1-5-9-13-17(19(21)23-15-11-7-3)18(14-10-6-2)20(22)24-16-12-8-4/h5-16H2,1-4H3/b18-17- |
| InChIKey | ZLAYNMZYTFLYBS-ZCXUNETKSA-N |
| XLogP | 5.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze dibutyl (Z)-2,3-dibutylbut-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibutyl (Z)-2,3-dibutylbut-2-enedioate?
The IUPAC name of dibutyl (Z)-2,3-dibutylbut-2-enedioate (CID 87559557) is dibutyl (Z)-2,3-dibutylbut-2-enedioate.
What is the SMILES notation for dibutyl (Z)-2,3-dibutylbut-2-enedioate?
The canonical SMILES for dibutyl (Z)-2,3-dibutylbut-2-enedioate is CCCCOC(=O)/C(CCCC)=C(/CCCC)C(=O)OCCCC.
What is the InChIKey of dibutyl (Z)-2,3-dibutylbut-2-enedioate?
The InChIKey is ZLAYNMZYTFLYBS-ZCXUNETKSA-N. The full InChI is InChI=1S/C20H36O4/c1-5-9-13-17(19(21)23-15-11-7-3)18(14-10-6-2)20(22)24-16-12-8-4/h5-16H2,1-4H3/b18-17-.
What are the key properties of dibutyl (Z)-2,3-dibutylbut-2-enedioate?
dibutyl (Z)-2,3-dibutylbut-2-enedioate has a molecular weight of 340.50 g/mol, XLogP of 5.35, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dibutyl (Z)-2,3-dibutylbut-2-enedioate is sourced from PubChem (CID 87559557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).