C15H39NO2Si3 — CID 87559726
4-[diethoxy(methyl)silyl]-N,N-bis(trimethylsilyl)butan-1-amine (PubChem CID 87559726) has the molecular formula C15H39NO2Si3 and a molecular weight of 349.74 g/mol. Its IUPAC name is 4-[diethoxy(methyl)silyl]-N,N-bis(trimethylsilyl)butan-1-amine.
| Compound Name | 4-[diethoxy(methyl)silyl]-N,N-bis(trimethylsilyl)butan-1-amine |
|---|---|
| PubChem CID | 87559726 |
| Molecular Formula | C15H39NO2Si3 |
| Molecular Weight | 349.74 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | 4-[diethoxy(methyl)silyl]-N,N-bis(trimethylsilyl)butan-1-amine |
| SMILES | CCO[Si](C)(CCCCN([Si](C)(C)C)[Si](C)(C)C)OCC |
| InChI | InChI=1S/C15H39NO2Si3/c1-10-17-21(9,18-11-2)15-13-12-14-16(19(3,4)5)20(6,7)8/h10-15H2,1-9H3 |
| InChIKey | FZLGAEDJRIBUTM-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.74 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|