About (2,5-dioxopyrrol-1-yl) carbonochloridate
(2,5-dioxopyrrol-1-yl) carbonochloridate (PubChem CID 87560005) has the molecular formula C5H2ClNO4
and a molecular weight of 175.53 g/mol. Its IUPAC name is (2,5-dioxopyrrol-1-yl) carbonochloridate.
Molecular Properties
| Compound Name | (2,5-dioxopyrrol-1-yl) carbonochloridate |
| PubChem CID | 87560005 |
| Molecular Formula | C5H2ClNO4 |
| Molecular Weight | 175.53 g/mol |
| Exact Mass | 174.97 |
| IUPAC Name | (2,5-dioxopyrrol-1-yl) carbonochloridate |
| SMILES | O=C(Cl)ON1C(=O)C=CC1=O |
| InChI | InChI=1S/C5H2ClNO4/c6-5(10)11-7-3(8)1-2-4(7)9/h1-2H |
| InChIKey | DVHKYNFPMGFCIY-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.53 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxopyrrol-1-yl) carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxopyrrol-1-yl) carbonochloridate?
The IUPAC name of (2,5-dioxopyrrol-1-yl) carbonochloridate (CID 87560005) is (2,5-dioxopyrrol-1-yl) carbonochloridate.
What is the SMILES notation for (2,5-dioxopyrrol-1-yl) carbonochloridate?
The canonical SMILES for (2,5-dioxopyrrol-1-yl) carbonochloridate is O=C(Cl)ON1C(=O)C=CC1=O.
What is the InChIKey of (2,5-dioxopyrrol-1-yl) carbonochloridate?
The InChIKey is DVHKYNFPMGFCIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H2ClNO4/c6-5(10)11-7-3(8)1-2-4(7)9/h1-2H.
What are the key properties of (2,5-dioxopyrrol-1-yl) carbonochloridate?
(2,5-dioxopyrrol-1-yl) carbonochloridate has a molecular weight of 175.53 g/mol, XLogP of 0.20, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrol-1-yl) carbonochloridate is sourced from PubChem (CID 87560005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).