C10H15BN2O4S — CID 87560497
[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]carbamic acid (PubChem CID 87560497) has the molecular formula C10H15BN2O4S and a molecular weight of 270.12 g/mol. Its IUPAC name is [5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]carbamic acid.
| Compound Name | [5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]carbamic acid |
|---|---|
| PubChem CID | 87560497 |
| Molecular Formula | C10H15BN2O4S |
| Molecular Weight | 270.12 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | [5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]carbamic acid |
| SMILES | CC1(C)OB(c2cnc(NC(=O)O)s2)OC1(C)C |
| InChI | InChI=1S/C10H15BN2O4S/c1-9(2)10(3,4)17-11(16-9)6-5-12-7(18-6)13-8(14)15/h5H,1-4H3,(H,12,13)(H,14,15) |
| InChIKey | ULKSAOWDGMBQHV-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.12 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|