C19H22F6N2O3 — CID 87560603
tert-butyl-[(3R,5R,6S)-6-methyl-2-oxo-1-(2,2,2-trifluoroethyl)-5-(2,3,6-trifluorophenyl)piperidin-3-yl]carbamic acid (PubChem CID 87560603) has the molecular formula C19H22F6N2O3 and a molecular weight of 440.38 g/mol. Its IUPAC name is tert-butyl-[(3R,5R,6S)-6-methyl-2-oxo-1-(2,2,2-trifluoroethyl)-5-(2,3,6-trifluorophenyl)piperidin-3-yl]carbamic acid.
| Compound Name | tert-butyl-[(3R,5R,6S)-6-methyl-2-oxo-1-(2,2,2-trifluoroethyl)-5-(2,3,6-trifluorophenyl)piperidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 87560603 |
| Molecular Formula | C19H22F6N2O3 |
| Molecular Weight | 440.38 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | tert-butyl-[(3R,5R,6S)-6-methyl-2-oxo-1-(2,2,2-trifluoroethyl)-5-(2,3,6-trifluorophenyl)piperidin-3-yl]carbamic acid |
| SMILES | C[C@H]1[C@@H](c2c(F)ccc(F)c2F)C[C@@H](N(C(=O)O)C(C)(C)C)C(=O)N1CC(F)(F)F |
| InChI | InChI=1S/C19H22F6N2O3/c1-9-10(14-11(20)5-6-12(21)15(14)22)7-13(27(17(29)30)18(2,3)4)16(28)26(9)8-19(23,24)25/h5-6,9-10,13H,7-8H2,1-4H3,(H,29,30)/t9-,10-,13+/m0/s1 |
| InChIKey | RSLHGFVXZPOGML-OUJBWJOFSA-N |
| XLogP | 4.52 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.38 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|