C18H18BrN5S — CID 87560938
2-(2,3-dimethyl-1,5-diphenyltetrazol-1-ium-1-yl)-1,3-thiazole bromide (PubChem CID 87560938) has the molecular formula C18H18BrN5S and a molecular weight of 416.35 g/mol. Its IUPAC name is 2-(2,3-dimethyl-1,5-diphenyltetrazol-1-ium-1-yl)-1,3-thiazole bromide.
| Compound Name | 2-(2,3-dimethyl-1,5-diphenyltetrazol-1-ium-1-yl)-1,3-thiazole bromide |
|---|---|
| PubChem CID | 87560938 |
| Molecular Formula | C18H18BrN5S |
| Molecular Weight | 416.35 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | 2-(2,3-dimethyl-1,5-diphenyltetrazol-1-ium-1-yl)-1,3-thiazole bromide |
| SMILES | CN1N=C(c2ccccc2)[N+](c2ccccc2)(c2nccs2)N1C.[Br-] |
| InChI | InChI=1S/C18H18N5S.BrH/c1-21-20-17(15-9-5-3-6-10-15)23(22(21)2,18-19-13-14-24-18)16-11-7-4-8-12-16;/h3-14H,1-2H3;1H/q+1;/p-1 |
| InChIKey | PYQZDCMRXSLURZ-UHFFFAOYSA-M |
| XLogP | 0.86 |
| TPSA | 31.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.35 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|