About 4-(1-chloropyrido[3,4-d]pyridazin-4-yl)-3-methylpiperazine-1-carboxylic acid
4-(1-chloropyrido[3,4-d]pyridazin-4-yl)-3-methylpiperazine-1-carboxylic acid (PubChem CID 87561009) has the molecular formula C13H14ClN5O2
and a molecular weight of 307.74 g/mol. Its IUPAC name is 4-(1-chloropyrido[3,4-d]pyridazin-4-yl)-3-methylpiperazine-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-(1-chloropyrido[3,4-d]pyridazin-4-yl)-3-methylpiperazine-1-carboxylic acid |
| PubChem CID | 87561009 |
| Molecular Formula | C13H14ClN5O2 |
| Molecular Weight | 307.74 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 4-(1-chloropyrido[3,4-d]pyridazin-4-yl)-3-methylpiperazine-1-carboxylic acid |
| SMILES | CC1CN(C(=O)O)CCN1c1nnc(Cl)c2ccncc12 |
| InChI | InChI=1S/C13H14ClN5O2/c1-8-7-18(13(20)21)4-5-19(8)12-10-6-15-3-2-9(10)11(14)16-17-12/h2-3,6,8H,4-5,7H2,1H3,(H,20,21) |
| InChIKey | BMSIOACLDHYOIJ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.74 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(1-chloropyrido[3,4-d]pyridazin-4-yl)-3-methylpiperazine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-chloropyrido[3,4-d]pyridazin-4-yl)-3-methylpiperazine-1-carboxylic acid?
The IUPAC name of 4-(1-chloropyrido[3,4-d]pyridazin-4-yl)-3-methylpiperazine-1-carboxylic acid (CID 87561009) is 4-(1-chloropyrido[3,4-d]pyridazin-4-yl)-3-methylpiperazine-1-carboxylic acid.
What is the SMILES notation for 4-(1-chloropyrido[3,4-d]pyridazin-4-yl)-3-methylpiperazine-1-carboxylic acid?
The canonical SMILES for 4-(1-chloropyrido[3,4-d]pyridazin-4-yl)-3-methylpiperazine-1-carboxylic acid is CC1CN(C(=O)O)CCN1c1nnc(Cl)c2ccncc12.
What is the InChIKey of 4-(1-chloropyrido[3,4-d]pyridazin-4-yl)-3-methylpiperazine-1-carboxylic acid?
The InChIKey is BMSIOACLDHYOIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14ClN5O2/c1-8-7-18(13(20)21)4-5-19(8)12-10-6-15-3-2-9(10)11(14)16-17-12/h2-3,6,8H,4-5,7H2,1H3,(H,20,21).
What are the key properties of 4-(1-chloropyrido[3,4-d]pyridazin-4-yl)-3-methylpiperazine-1-carboxylic acid?
4-(1-chloropyrido[3,4-d]pyridazin-4-yl)-3-methylpiperazine-1-carboxylic acid has a molecular weight of 307.74 g/mol, XLogP of 1.87, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-chloropyrido[3,4-d]pyridazin-4-yl)-3-methylpiperazine-1-carboxylic acid is sourced from PubChem (CID 87561009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).