C15H21ClF2N4 — CID 87561171
2-chloro-9-(3,3-difluorocyclopentyl)-5,7,7-trimethyl-6,8-dihydropyrimido[4,5-b][1,4]diazepine (PubChem CID 87561171) has the molecular formula C15H21ClF2N4 and a molecular weight of 330.81 g/mol. Its IUPAC name is 2-chloro-9-(3,3-difluorocyclopentyl)-5,7,7-trimethyl-6,8-dihydropyrimido[4,5-b][1,4]diazepine.
| Compound Name | 2-chloro-9-(3,3-difluorocyclopentyl)-5,7,7-trimethyl-6,8-dihydropyrimido[4,5-b][1,4]diazepine |
|---|---|
| PubChem CID | 87561171 |
| Molecular Formula | C15H21ClF2N4 |
| Molecular Weight | 330.81 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 2-chloro-9-(3,3-difluorocyclopentyl)-5,7,7-trimethyl-6,8-dihydropyrimido[4,5-b][1,4]diazepine |
| SMILES | CN1CC(C)(C)CN(C2CCC(F)(F)C2)c2nc(Cl)ncc21 |
| InChI | InChI=1S/C15H21ClF2N4/c1-14(2)8-21(3)11-7-19-13(16)20-12(11)22(9-14)10-4-5-15(17,18)6-10/h7,10H,4-6,8-9H2,1-3H3 |
| InChIKey | VWHZKQPYUFMAQM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.81 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |