About magnesium;propylsulfanylbenzene;bromide
magnesium;propylsulfanylbenzene;bromide (PubChem CID 87561470) has the molecular formula C9H11BrMgS
and a molecular weight of 255.46 g/mol. Its IUPAC name is magnesium;propylsulfanylbenzene;bromide.
Molecular Properties
| Compound Name | magnesium;propylsulfanylbenzene;bromide |
| PubChem CID | 87561470 |
| Molecular Formula | C9H11BrMgS |
| Molecular Weight | 255.46 g/mol |
| Exact Mass | 253.96 |
| IUPAC Name | magnesium;propylsulfanylbenzene;bromide |
| SMILES | CCCSc1cc[c-]cc1.[Br-].[Mg+2] |
| InChI | InChI=1S/C9H11S.BrH.Mg/c1-2-8-10-9-6-4-3-5-7-9;;/h4-7H,2,8H2,1H3;1H;/q-1;;+2/p-1 |
| InChIKey | AHIRUFKSLCRSFX-UHFFFAOYSA-M |
| XLogP | -0.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.46 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze magnesium;propylsulfanylbenzene;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;propylsulfanylbenzene;bromide?
The IUPAC name of magnesium;propylsulfanylbenzene;bromide (CID 87561470) is magnesium;propylsulfanylbenzene;bromide.
What is the SMILES notation for magnesium;propylsulfanylbenzene;bromide?
The canonical SMILES for magnesium;propylsulfanylbenzene;bromide is CCCSc1cc[c-]cc1.[Br-].[Mg+2].
What is the InChIKey of magnesium;propylsulfanylbenzene;bromide?
The InChIKey is AHIRUFKSLCRSFX-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H11S.BrH.Mg/c1-2-8-10-9-6-4-3-5-7-9;;/h4-7H,2,8H2,1H3;1H;/q-1;;+2/p-1.
What are the key properties of magnesium;propylsulfanylbenzene;bromide?
magnesium;propylsulfanylbenzene;bromide has a molecular weight of 255.46 g/mol, XLogP of -0.39, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;propylsulfanylbenzene;bromide is sourced from PubChem (CID 87561470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).