About 3-[(2-chlorofuro[3,2-d]pyrimidin-4-yl)amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide
3-[(2-chlorofuro[3,2-d]pyrimidin-4-yl)amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 87561544) has the molecular formula C14H13ClN4O2
and a molecular weight of 304.74 g/mol. Its IUPAC name is 3-[(2-chlorofuro[3,2-d]pyrimidin-4-yl)amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
Molecular Properties
| Compound Name | 3-[(2-chlorofuro[3,2-d]pyrimidin-4-yl)amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| PubChem CID | 87561544 |
| Molecular Formula | C14H13ClN4O2 |
| Molecular Weight | 304.74 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 3-[(2-chlorofuro[3,2-d]pyrimidin-4-yl)amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | NC(=O)C1C2C=CC(C2)C1Nc1nc(Cl)nc2ccoc12 |
| InChI | InChI=1S/C14H13ClN4O2/c15-14-17-8-3-4-21-11(8)13(19-14)18-10-7-2-1-6(5-7)9(10)12(16)20/h1-4,6-7,9-10H,5H2,(H2,16,20)(H,17,18,19) |
| InChIKey | CGLCXOOJNILAGK-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.74 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2-chlorofuro[3,2-d]pyrimidin-4-yl)amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-chlorofuro[3,2-d]pyrimidin-4-yl)amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide?
The IUPAC name of 3-[(2-chlorofuro[3,2-d]pyrimidin-4-yl)amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide (CID 87561544) is 3-[(2-chlorofuro[3,2-d]pyrimidin-4-yl)amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
What is the SMILES notation for 3-[(2-chlorofuro[3,2-d]pyrimidin-4-yl)amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide?
The canonical SMILES for 3-[(2-chlorofuro[3,2-d]pyrimidin-4-yl)amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide is NC(=O)C1C2C=CC(C2)C1Nc1nc(Cl)nc2ccoc12.
What is the InChIKey of 3-[(2-chlorofuro[3,2-d]pyrimidin-4-yl)amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide?
The InChIKey is CGLCXOOJNILAGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13ClN4O2/c15-14-17-8-3-4-21-11(8)13(19-14)18-10-7-2-1-6(5-7)9(10)12(16)20/h1-4,6-7,9-10H,5H2,(H2,16,20)(H,17,18,19).
What are the key properties of 3-[(2-chlorofuro[3,2-d]pyrimidin-4-yl)amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide?
3-[(2-chlorofuro[3,2-d]pyrimidin-4-yl)amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide has a molecular weight of 304.74 g/mol, XLogP of 1.96, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-chlorofuro[3,2-d]pyrimidin-4-yl)amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide is sourced from PubChem (CID 87561544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).