About N-[(5-amino-1,2,4-thiadiazol-3-yl)methyl]formamide
N-[(5-amino-1,2,4-thiadiazol-3-yl)methyl]formamide (PubChem CID 87561586) has the molecular formula C4H6N4OS
and a molecular weight of 158.19 g/mol. Its IUPAC name is N-[(5-amino-1,2,4-thiadiazol-3-yl)methyl]formamide.
Molecular Properties
| Compound Name | N-[(5-amino-1,2,4-thiadiazol-3-yl)methyl]formamide |
| PubChem CID | 87561586 |
| Molecular Formula | C4H6N4OS |
| Molecular Weight | 158.19 g/mol |
| Exact Mass | 158.03 |
| IUPAC Name | N-[(5-amino-1,2,4-thiadiazol-3-yl)methyl]formamide |
| SMILES | Nc1nc(CNC=O)ns1 |
| InChI | InChI=1S/C4H6N4OS/c5-4-7-3(8-10-4)1-6-2-9/h2H,1H2,(H,6,9)(H2,5,7,8) |
| InChIKey | GUUNHARTILALKO-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.19 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[(5-amino-1,2,4-thiadiazol-3-yl)methyl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-amino-1,2,4-thiadiazol-3-yl)methyl]formamide?
The IUPAC name of N-[(5-amino-1,2,4-thiadiazol-3-yl)methyl]formamide (CID 87561586) is N-[(5-amino-1,2,4-thiadiazol-3-yl)methyl]formamide.
What is the SMILES notation for N-[(5-amino-1,2,4-thiadiazol-3-yl)methyl]formamide?
The canonical SMILES for N-[(5-amino-1,2,4-thiadiazol-3-yl)methyl]formamide is Nc1nc(CNC=O)ns1.
What is the InChIKey of N-[(5-amino-1,2,4-thiadiazol-3-yl)methyl]formamide?
The InChIKey is GUUNHARTILALKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N4OS/c5-4-7-3(8-10-4)1-6-2-9/h2H,1H2,(H,6,9)(H2,5,7,8).
What are the key properties of N-[(5-amino-1,2,4-thiadiazol-3-yl)methyl]formamide?
N-[(5-amino-1,2,4-thiadiazol-3-yl)methyl]formamide has a molecular weight of 158.19 g/mol, XLogP of -0.63, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-amino-1,2,4-thiadiazol-3-yl)methyl]formamide is sourced from PubChem (CID 87561586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).