C22H21Cl2N3O3S — CID 87561835
2-[4-[2-(2,4-dichlorophenyl)ethyl]-3,6-dioxo-1-prop-2-ynylpiperazin-2-yl]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 87561835) has the molecular formula C22H21Cl2N3O3S and a molecular weight of 478.40 g/mol. Its IUPAC name is 2-[4-[2-(2,4-dichlorophenyl)ethyl]-3,6-dioxo-1-prop-2-ynylpiperazin-2-yl]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[4-[2-(2,4-dichlorophenyl)ethyl]-3,6-dioxo-1-prop-2-ynylpiperazin-2-yl]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 87561835 |
| Molecular Formula | C22H21Cl2N3O3S |
| Molecular Weight | 478.40 g/mol |
| Exact Mass | 477.07 |
| IUPAC Name | 2-[4-[2-(2,4-dichlorophenyl)ethyl]-3,6-dioxo-1-prop-2-ynylpiperazin-2-yl]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | C#CCN1C(=O)CN(CCc2ccc(Cl)cc2Cl)C(=O)C1CC(=O)NCc1cccs1 |
| InChI | InChI=1S/C22H21Cl2N3O3S/c1-2-8-27-19(12-20(28)25-13-17-4-3-10-31-17)22(30)26(14-21(27)29)9-7-15-5-6-16(23)11-18(15)24/h1,3-6,10-11,19H,7-9,12-14H2,(H,25,28) |
| InChIKey | XGLWFHJJWZVXMB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|