C12H14F3N3O2Pd — CID 87562100
1-(7,8-diamino-5-hydroxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl)-2,2,2-trifluoroethanone;palladium (PubChem CID 87562100) has the molecular formula C12H14F3N3O2Pd and a molecular weight of 395.68 g/mol. Its IUPAC name is 1-(7,8-diamino-5-hydroxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl)-2,2,2-trifluoroethanone;palladium.
| Compound Name | 1-(7,8-diamino-5-hydroxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl)-2,2,2-trifluoroethanone;palladium |
|---|---|
| PubChem CID | 87562100 |
| Molecular Formula | C12H14F3N3O2Pd |
| Molecular Weight | 395.68 g/mol |
| Exact Mass | 395.01 |
| IUPAC Name | 1-(7,8-diamino-5-hydroxy-1,2,4,5-tetrahydro-3-benzazepin-3-yl)-2,2,2-trifluoroethanone;palladium |
| SMILES | Nc1cc2c(cc1N)C(O)CN(C(=O)C(F)(F)F)CC2.[Pd] |
| InChI | InChI=1S/C12H14F3N3O2.Pd/c13-12(14,15)11(20)18-2-1-6-3-8(16)9(17)4-7(6)10(19)5-18;/h3-4,10,19H,1-2,5,16-17H2; |
| InChIKey | SIWYOWJBZUKBJX-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 92.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.68 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|