C13H14IO4+ — CID 87562106
(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-(4-methylphenyl)iodanium (PubChem CID 87562106) has the molecular formula C13H14IO4+ and a molecular weight of 361.16 g/mol. Its IUPAC name is (2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-(4-methylphenyl)iodanium.
| Compound Name | (2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-(4-methylphenyl)iodanium |
|---|---|
| PubChem CID | 87562106 |
| Molecular Formula | C13H14IO4+ |
| Molecular Weight | 361.16 g/mol |
| Exact Mass | 360.99 |
| IUPAC Name | (2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-(4-methylphenyl)iodanium |
| SMILES | Cc1ccc([I+]C2C(=O)OC(C)(C)OC2=O)cc1 |
| InChI | InChI=1S/C13H14IO4/c1-8-4-6-9(7-5-8)14-10-11(15)17-13(2,3)18-12(10)16/h4-7,10H,1-3H3/q+1 |
| InChIKey | GLGVZKFTGXPERL-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.16 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|