C22H32O5 — CID 87562846
4-[(11R,14S)-11-methyl-14-propan-2-yl-7,8,15,16-tetraoxadispiro[5.2.59.26]hexadecan-3-yl]phenol (PubChem CID 87562846) has the molecular formula C22H32O5 and a molecular weight of 376.49 g/mol. Its IUPAC name is 4-[(11R,14S)-11-methyl-14-propan-2-yl-7,8,15,16-tetraoxadispiro[5.2.59.26]hexadecan-3-yl]phenol.
| Compound Name | 4-[(11R,14S)-11-methyl-14-propan-2-yl-7,8,15,16-tetraoxadispiro[5.2.59.26]hexadecan-3-yl]phenol |
|---|---|
| PubChem CID | 87562846 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 4-[(11R,14S)-11-methyl-14-propan-2-yl-7,8,15,16-tetraoxadispiro[5.2.59.26]hexadecan-3-yl]phenol |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)CC12OOC1(CCC(c3ccc(O)cc3)CC1)OO2 |
| InChI | InChI=1S/C22H32O5/c1-15(2)20-9-4-16(3)14-22(20)26-24-21(25-27-22)12-10-18(11-13-21)17-5-7-19(23)8-6-17/h5-8,15-16,18,20,23H,4,9-14H2,1-3H3/t16-,18?,20+,21?,22?/m1/s1 |
| InChIKey | RDRFSYZFDLLQOL-SPXLZHQTSA-N |
| XLogP | 5.44 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|