C11H15ClN4O2 — CID 87563176
3-[[2-chloro-5-[(E)-2-ethoxyethenyl]pyrimidin-4-yl]amino]propanamide (PubChem CID 87563176) has the molecular formula C11H15ClN4O2 and a molecular weight of 270.72 g/mol. Its IUPAC name is 3-[[2-chloro-5-[(E)-2-ethoxyethenyl]pyrimidin-4-yl]amino]propanamide.
| Compound Name | 3-[[2-chloro-5-[(E)-2-ethoxyethenyl]pyrimidin-4-yl]amino]propanamide |
|---|---|
| PubChem CID | 87563176 |
| Molecular Formula | C11H15ClN4O2 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 3-[[2-chloro-5-[(E)-2-ethoxyethenyl]pyrimidin-4-yl]amino]propanamide |
| SMILES | CCO/C=C/c1cnc(Cl)nc1NCCC(N)=O |
| InChI | InChI=1S/C11H15ClN4O2/c1-2-18-6-4-8-7-15-11(12)16-10(8)14-5-3-9(13)17/h4,6-7H,2-3,5H2,1H3,(H2,13,17)(H,14,15,16)/b6-4+ |
| InChIKey | ILFUJBNORLSWAJ-GQCTYLIASA-N |
| XLogP | 1.42 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|