About (E)-3-(1,5-difluorocyclohexa-2,4-dien-1-yl)prop-2-enal
(E)-3-(1,5-difluorocyclohexa-2,4-dien-1-yl)prop-2-enal (PubChem CID 87563566) has the molecular formula C9H8F2O
and a molecular weight of 170.16 g/mol. Its IUPAC name is (E)-3-(1,5-difluorocyclohexa-2,4-dien-1-yl)prop-2-enal.
Molecular Properties
| Compound Name | (E)-3-(1,5-difluorocyclohexa-2,4-dien-1-yl)prop-2-enal |
| PubChem CID | 87563566 |
| Molecular Formula | C9H8F2O |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | (E)-3-(1,5-difluorocyclohexa-2,4-dien-1-yl)prop-2-enal |
| SMILES | O=C/C=C/C1(F)C=CC=C(F)C1 |
| InChI | InChI=1S/C9H8F2O/c10-8-3-1-4-9(11,7-8)5-2-6-12/h1-6H,7H2/b5-2+ |
| InChIKey | VJNOTHWGTSYODN-GORDUTHDSA-N |
| XLogP | 2.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(1,5-difluorocyclohexa-2,4-dien-1-yl)prop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(1,5-difluorocyclohexa-2,4-dien-1-yl)prop-2-enal?
The IUPAC name of (E)-3-(1,5-difluorocyclohexa-2,4-dien-1-yl)prop-2-enal (CID 87563566) is (E)-3-(1,5-difluorocyclohexa-2,4-dien-1-yl)prop-2-enal.
What is the SMILES notation for (E)-3-(1,5-difluorocyclohexa-2,4-dien-1-yl)prop-2-enal?
The canonical SMILES for (E)-3-(1,5-difluorocyclohexa-2,4-dien-1-yl)prop-2-enal is O=C/C=C/C1(F)C=CC=C(F)C1.
What is the InChIKey of (E)-3-(1,5-difluorocyclohexa-2,4-dien-1-yl)prop-2-enal?
The InChIKey is VJNOTHWGTSYODN-GORDUTHDSA-N. The full InChI is InChI=1S/C9H8F2O/c10-8-3-1-4-9(11,7-8)5-2-6-12/h1-6H,7H2/b5-2+.
What are the key properties of (E)-3-(1,5-difluorocyclohexa-2,4-dien-1-yl)prop-2-enal?
(E)-3-(1,5-difluorocyclohexa-2,4-dien-1-yl)prop-2-enal has a molecular weight of 170.16 g/mol, XLogP of 2.26, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(1,5-difluorocyclohexa-2,4-dien-1-yl)prop-2-enal is sourced from PubChem (CID 87563566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).