C29H26N4O3 — CID 87563688
7-amino-N-hydroxy-6-[4-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]phenyl]isoquinoline-8-carboxamide (PubChem CID 87563688) has the molecular formula C29H26N4O3 and a molecular weight of 478.55 g/mol. Its IUPAC name is 7-amino-N-hydroxy-6-[4-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]phenyl]isoquinoline-8-carboxamide.
| Compound Name | 7-amino-N-hydroxy-6-[4-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]phenyl]isoquinoline-8-carboxamide |
|---|---|
| PubChem CID | 87563688 |
| Molecular Formula | C29H26N4O3 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | 7-amino-N-hydroxy-6-[4-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]phenyl]isoquinoline-8-carboxamide |
| SMILES | Nc1c(-c2ccc(C#Cc3ccc(CN4CCOCC4)cc3)cc2)cc2ccncc2c1C(=O)NO |
| InChI | InChI=1S/C29H26N4O3/c30-28-25(17-24-11-12-31-18-26(24)27(28)29(34)32-35)23-9-7-21(8-10-23)2-1-20-3-5-22(6-4-20)19-33-13-15-36-16-14-33/h3-12,17-18,35H,13-16,19,30H2,(H,32,34) |
| InChIKey | CSXOEZYRPVZXDN-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|