C22H23NO3 — CID 87563922
2-[2-(4-butan-2-yloxy-2-methylphenoxy)quinolin-6-yl]acetaldehyde (PubChem CID 87563922) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is 2-[2-(4-butan-2-yloxy-2-methylphenoxy)quinolin-6-yl]acetaldehyde.
| Compound Name | 2-[2-(4-butan-2-yloxy-2-methylphenoxy)quinolin-6-yl]acetaldehyde |
|---|---|
| PubChem CID | 87563922 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 2-[2-(4-butan-2-yloxy-2-methylphenoxy)quinolin-6-yl]acetaldehyde |
| SMILES | CCC(C)Oc1ccc(Oc2ccc3cc(CC=O)ccc3n2)c(C)c1 |
| InChI | InChI=1S/C22H23NO3/c1-4-16(3)25-19-7-9-21(15(2)13-19)26-22-10-6-18-14-17(11-12-24)5-8-20(18)23-22/h5-10,12-14,16H,4,11H2,1-3H3 |
| InChIKey | DPADTWHUQZYQFC-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|