About 1-(1-hydroxycyclohexyl)cyclohexa-2,4-diene-1-carbaldehyde
1-(1-hydroxycyclohexyl)cyclohexa-2,4-diene-1-carbaldehyde (PubChem CID 87564190) has the molecular formula C13H18O2
and a molecular weight of 206.29 g/mol. Its IUPAC name is 1-(1-hydroxycyclohexyl)cyclohexa-2,4-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | 1-(1-hydroxycyclohexyl)cyclohexa-2,4-diene-1-carbaldehyde |
| PubChem CID | 87564190 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 1-(1-hydroxycyclohexyl)cyclohexa-2,4-diene-1-carbaldehyde |
| SMILES | O=CC1(C2(O)CCCCC2)C=CC=CC1 |
| InChI | InChI=1S/C13H18O2/c14-11-12(7-3-1-4-8-12)13(15)9-5-2-6-10-13/h1,3-4,7,11,15H,2,5-6,8-10H2 |
| InChIKey | PKBNQHRFULGSHJ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-hydroxycyclohexyl)cyclohexa-2,4-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-hydroxycyclohexyl)cyclohexa-2,4-diene-1-carbaldehyde?
The IUPAC name of 1-(1-hydroxycyclohexyl)cyclohexa-2,4-diene-1-carbaldehyde (CID 87564190) is 1-(1-hydroxycyclohexyl)cyclohexa-2,4-diene-1-carbaldehyde.
What is the SMILES notation for 1-(1-hydroxycyclohexyl)cyclohexa-2,4-diene-1-carbaldehyde?
The canonical SMILES for 1-(1-hydroxycyclohexyl)cyclohexa-2,4-diene-1-carbaldehyde is O=CC1(C2(O)CCCCC2)C=CC=CC1.
What is the InChIKey of 1-(1-hydroxycyclohexyl)cyclohexa-2,4-diene-1-carbaldehyde?
The InChIKey is PKBNQHRFULGSHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2/c14-11-12(7-3-1-4-8-12)13(15)9-5-2-6-10-13/h1,3-4,7,11,15H,2,5-6,8-10H2.
What are the key properties of 1-(1-hydroxycyclohexyl)cyclohexa-2,4-diene-1-carbaldehyde?
1-(1-hydroxycyclohexyl)cyclohexa-2,4-diene-1-carbaldehyde has a molecular weight of 206.29 g/mol, XLogP of 2.38, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-hydroxycyclohexyl)cyclohexa-2,4-diene-1-carbaldehyde is sourced from PubChem (CID 87564190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).