C27H18F26O7S — CID 87564889
2-(4-methylphenyl)sulfonyloxy-2,3-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)butanedioic acid (PubChem CID 87564889) has the molecular formula C27H18F26O7S and a molecular weight of 980.45 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfonyloxy-2,3-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)butanedioic acid.
| Compound Name | 2-(4-methylphenyl)sulfonyloxy-2,3-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)butanedioic acid |
|---|---|
| PubChem CID | 87564889 |
| Molecular Formula | C27H18F26O7S |
| Molecular Weight | 980.45 g/mol |
| Exact Mass | 980.04 |
| IUPAC Name | 2-(4-methylphenyl)sulfonyloxy-2,3-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)butanedioic acid |
| SMILES | Cc1ccc(S(=O)(=O)OC(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(C(=O)O)C(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)O)cc1 |
| InChI | InChI=1S/C27H18F26O7S/c1-10-2-4-11(5-3-10)61(58,59)60-15(14(56)57,8-9-17(30,31)19(34,35)21(38,39)23(42,43)25(46,47)27(51,52)53)12(13(54)55)6-7-16(28,29)18(32,33)20(36,37)22(40,41)24(44,45)26(48,49)50/h2-5,12H,6-9H2,1H3,(H,54,55)(H,56,57) |
| InChIKey | QKONGMGLUZDIQY-UHFFFAOYSA-N |
| XLogP | 10.26 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 980.45 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|