About 1H-pyrido[4,3-b]indole-8-carboxamide
1H-pyrido[4,3-b]indole-8-carboxamide (PubChem CID 87564959) has the molecular formula C12H9N3O
and a molecular weight of 211.22 g/mol. Its IUPAC name is 1H-pyrido[4,3-b]indole-8-carboxamide.
Molecular Properties
| Compound Name | 1H-pyrido[4,3-b]indole-8-carboxamide |
| PubChem CID | 87564959 |
| Molecular Formula | C12H9N3O |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | 1H-pyrido[4,3-b]indole-8-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)=C1CN=CC=C1N=2 |
| InChI | InChI=1S/C12H9N3O/c13-12(16)7-1-2-10-8(5-7)9-6-14-4-3-11(9)15-10/h1-5H,6H2,(H2,13,16) |
| InChIKey | CVNAOYBBEACKFC-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 67.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-pyrido[4,3-b]indole-8-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrido[4,3-b]indole-8-carboxamide?
The IUPAC name of 1H-pyrido[4,3-b]indole-8-carboxamide (CID 87564959) is 1H-pyrido[4,3-b]indole-8-carboxamide.
What is the SMILES notation for 1H-pyrido[4,3-b]indole-8-carboxamide?
The canonical SMILES for 1H-pyrido[4,3-b]indole-8-carboxamide is NC(=O)c1ccc2c(c1)=C1CN=CC=C1N=2.
What is the InChIKey of 1H-pyrido[4,3-b]indole-8-carboxamide?
The InChIKey is CVNAOYBBEACKFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N3O/c13-12(16)7-1-2-10-8(5-7)9-6-14-4-3-11(9)15-10/h1-5H,6H2,(H2,13,16).
What are the key properties of 1H-pyrido[4,3-b]indole-8-carboxamide?
1H-pyrido[4,3-b]indole-8-carboxamide has a molecular weight of 211.22 g/mol, XLogP of -0.46, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrido[4,3-b]indole-8-carboxamide is sourced from PubChem (CID 87564959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).