About dihydroxy-sulfanylidene-(2,4,6-trichlorophenoxy)-λ5-phosphane
dihydroxy-sulfanylidene-(2,4,6-trichlorophenoxy)-λ5-phosphane (PubChem CID 87564961) has the molecular formula C6H4Cl3O3PS
and a molecular weight of 293.50 g/mol. Its IUPAC name is dihydroxy-sulfanylidene-(2,4,6-trichlorophenoxy)-λ5-phosphane.
Molecular Properties
| Compound Name | dihydroxy-sulfanylidene-(2,4,6-trichlorophenoxy)-λ5-phosphane |
| PubChem CID | 87564961 |
| Molecular Formula | C6H4Cl3O3PS |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 291.87 |
| IUPAC Name | dihydroxy-sulfanylidene-(2,4,6-trichlorophenoxy)-λ5-phosphane |
| SMILES | OP(O)(=S)Oc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C6H4Cl3O3PS/c7-3-1-4(8)6(5(9)2-3)12-13(10,11)14/h1-2H,(H2,10,11,14) |
| InChIKey | UKZUOZLKSDKKLL-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy-sulfanylidene-(2,4,6-trichlorophenoxy)-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy-sulfanylidene-(2,4,6-trichlorophenoxy)-λ5-phosphane?
The IUPAC name of dihydroxy-sulfanylidene-(2,4,6-trichlorophenoxy)-λ5-phosphane (CID 87564961) is dihydroxy-sulfanylidene-(2,4,6-trichlorophenoxy)-λ5-phosphane.
What is the SMILES notation for dihydroxy-sulfanylidene-(2,4,6-trichlorophenoxy)-λ5-phosphane?
The canonical SMILES for dihydroxy-sulfanylidene-(2,4,6-trichlorophenoxy)-λ5-phosphane is OP(O)(=S)Oc1c(Cl)cc(Cl)cc1Cl.
What is the InChIKey of dihydroxy-sulfanylidene-(2,4,6-trichlorophenoxy)-λ5-phosphane?
The InChIKey is UKZUOZLKSDKKLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Cl3O3PS/c7-3-1-4(8)6(5(9)2-3)12-13(10,11)14/h1-2H,(H2,10,11,14).
What are the key properties of dihydroxy-sulfanylidene-(2,4,6-trichlorophenoxy)-λ5-phosphane?
dihydroxy-sulfanylidene-(2,4,6-trichlorophenoxy)-λ5-phosphane has a molecular weight of 293.50 g/mol, XLogP of 3.23, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy-sulfanylidene-(2,4,6-trichlorophenoxy)-λ5-phosphane is sourced from PubChem (CID 87564961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).