C24H43N5O9 — CID 87565016
[N,N'-bis[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl] (2S)-2-[[(2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]propanoate (PubChem CID 87565016) has the molecular formula C24H43N5O9 and a molecular weight of 545.63 g/mol. Its IUPAC name is [N,N'-bis[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl] (2S)-2-[[(2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]propanoate.
| Compound Name | [N,N'-bis[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl] (2S)-2-[[(2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]propanoate |
|---|---|
| PubChem CID | 87565016 |
| Molecular Formula | C24H43N5O9 |
| Molecular Weight | 545.63 g/mol |
| Exact Mass | 545.31 |
| IUPAC Name | [N,N'-bis[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl] (2S)-2-[[(2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]propanoate |
| SMILES | C[C@H](NC(=O)[C@H](CCCN)NC(=O)OC(C)(C)C)C(=O)OC(=NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H43N5O9/c1-14(26-16(30)15(12-11-13-25)27-19(32)36-22(2,3)4)17(31)35-18(28-20(33)37-23(5,6)7)29-21(34)38-24(8,9)10/h14-15H,11-13,25H2,1-10H3,(H,26,30)(H,27,32)(H,28,29,33,34)/t14-,15-/m0/s1 |
| InChIKey | JXJDUPHXBGCHGA-GJZGRUSLSA-N |
| XLogP | 2.48 |
| TPSA | 196.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.63 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|