C22H14F6N3O6S+ — CID 87565061
[2,4-dioxo-1-(quinolin-4-ylmethyl)-3-[4-(trifluoromethylsulfonyl)phenyl]imidazolidin-1-ium-1-yl] 2,2,2-trifluoroacetate (PubChem CID 87565061) has the molecular formula C22H14F6N3O6S+ and a molecular weight of 562.42 g/mol. Its IUPAC name is [2,4-dioxo-1-(quinolin-4-ylmethyl)-3-[4-(trifluoromethylsulfonyl)phenyl]imidazolidin-1-ium-1-yl] 2,2,2-trifluoroacetate.
| Compound Name | [2,4-dioxo-1-(quinolin-4-ylmethyl)-3-[4-(trifluoromethylsulfonyl)phenyl]imidazolidin-1-ium-1-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87565061 |
| Molecular Formula | C22H14F6N3O6S+ |
| Molecular Weight | 562.42 g/mol |
| Exact Mass | 562.05 |
| IUPAC Name | [2,4-dioxo-1-(quinolin-4-ylmethyl)-3-[4-(trifluoromethylsulfonyl)phenyl]imidazolidin-1-ium-1-yl] 2,2,2-trifluoroacetate |
| SMILES | O=C1C[N+](Cc2ccnc3ccccc23)(OC(=O)C(F)(F)F)C(=O)N1c1ccc(S(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H14F6N3O6S/c23-21(24,25)19(33)37-31(11-13-9-10-29-17-4-2-1-3-16(13)17)12-18(32)30(20(31)34)14-5-7-15(8-6-14)38(35,36)22(26,27)28/h1-10H,11-12H2/q+1 |
| InChIKey | MESCCQBAJXXLLT-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 110.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|