C30H16Br2F12 — CID 87565846
1-bromo-4-[2-[4-[4-[2-(4-bromophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]benzene (PubChem CID 87565846) has the molecular formula C30H16Br2F12 and a molecular weight of 764.24 g/mol. Its IUPAC name is 1-bromo-4-[2-[4-[4-[2-(4-bromophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]benzene.
| Compound Name | 1-bromo-4-[2-[4-[4-[2-(4-bromophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]benzene |
|---|---|
| PubChem CID | 87565846 |
| Molecular Formula | C30H16Br2F12 |
| Molecular Weight | 764.24 g/mol |
| Exact Mass | 761.94 |
| IUPAC Name | 1-bromo-4-[2-[4-[4-[2-(4-bromophenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]benzene |
| SMILES | FC(F)(F)C(c1ccc(Br)cc1)(c1ccc(-c2ccc(C(c3ccc(Br)cc3)(C(F)(F)F)C(F)(F)F)cc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C30H16Br2F12/c31-23-13-9-21(10-14-23)25(27(33,34)35,28(36,37)38)19-5-1-17(2-6-19)18-3-7-20(8-4-18)26(29(39,40)41,30(42,43)44)22-11-15-24(32)16-12-22/h1-16H |
| InChIKey | BJXKSLGOZVHHPY-UHFFFAOYSA-N |
| XLogP | 11.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.24 |
| LogP ≤ 5 | 11.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |