About 2-aminopentanedioic acid;penta-1,4-dien-3-one
2-aminopentanedioic acid;penta-1,4-dien-3-one (PubChem CID 87566422) has the molecular formula C10H15NO5
and a molecular weight of 229.23 g/mol. Its IUPAC name is 2-aminopentanedioic acid;penta-1,4-dien-3-one.
Molecular Properties
| Compound Name | 2-aminopentanedioic acid;penta-1,4-dien-3-one |
| PubChem CID | 87566422 |
| Molecular Formula | C10H15NO5 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 2-aminopentanedioic acid;penta-1,4-dien-3-one |
| SMILES | C=CC(=O)C=C.NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C5H9NO4.C5H6O/c6-3(5(9)10)1-2-4(7)8;1-3-5(6)4-2/h3H,1-2,6H2,(H,7,8)(H,9,10);3-4H,1-2H2 |
| InChIKey | FDTZTHREVJSLRU-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-aminopentanedioic acid;penta-1,4-dien-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminopentanedioic acid;penta-1,4-dien-3-one?
The IUPAC name of 2-aminopentanedioic acid;penta-1,4-dien-3-one (CID 87566422) is 2-aminopentanedioic acid;penta-1,4-dien-3-one.
What is the SMILES notation for 2-aminopentanedioic acid;penta-1,4-dien-3-one?
The canonical SMILES for 2-aminopentanedioic acid;penta-1,4-dien-3-one is C=CC(=O)C=C.NC(CCC(=O)O)C(=O)O.
What is the InChIKey of 2-aminopentanedioic acid;penta-1,4-dien-3-one?
The InChIKey is FDTZTHREVJSLRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO4.C5H6O/c6-3(5(9)10)1-2-4(7)8;1-3-5(6)4-2/h3H,1-2,6H2,(H,7,8)(H,9,10);3-4H,1-2H2.
What are the key properties of 2-aminopentanedioic acid;penta-1,4-dien-3-one?
2-aminopentanedioic acid;penta-1,4-dien-3-one has a molecular weight of 229.23 g/mol, XLogP of 0.19, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminopentanedioic acid;penta-1,4-dien-3-one is sourced from PubChem (CID 87566422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).