C21H19NS — CID 87566886
bicyclo[2.2.0]hexa-1,3,5-triene;N-(1-phenylethyl)-1-thiophen-2-ylprop-2-yn-1-amine (PubChem CID 87566886) has the molecular formula C21H19NS and a molecular weight of 317.46 g/mol. Its IUPAC name is bicyclo[2.2.0]hexa-1,3,5-triene;N-(1-phenylethyl)-1-thiophen-2-ylprop-2-yn-1-amine.
| Compound Name | bicyclo[2.2.0]hexa-1,3,5-triene;N-(1-phenylethyl)-1-thiophen-2-ylprop-2-yn-1-amine |
|---|---|
| PubChem CID | 87566886 |
| Molecular Formula | C21H19NS |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | bicyclo[2.2.0]hexa-1,3,5-triene;N-(1-phenylethyl)-1-thiophen-2-ylprop-2-yn-1-amine |
| SMILES | C#CC(NC(C)c1ccccc1)c1cccs1.c1cc2ccc1-2 |
| InChI | InChI=1S/C15H15NS.C6H4/c1-3-14(15-10-7-11-17-15)16-12(2)13-8-5-4-6-9-13;1-2-6-4-3-5(1)6/h1,4-12,14,16H,2H3;1-4H |
| InChIKey | COHNEAFNSKAKPY-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|