C17H17FN2O5 — CID 875669
3,5-diethoxy-N-(4-fluoro-3-nitrophenyl)benzamide (PubChem CID 875669) has the molecular formula C17H17FN2O5 and a molecular weight of 348.33 g/mol. Its IUPAC name is 3,5-diethoxy-N-(4-fluoro-3-nitrophenyl)benzamide.
| Compound Name | 3,5-diethoxy-N-(4-fluoro-3-nitrophenyl)benzamide |
|---|---|
| PubChem CID | 875669 |
| Molecular Formula | C17H17FN2O5 |
| Molecular Weight | 348.33 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 3,5-diethoxy-N-(4-fluoro-3-nitrophenyl)benzamide |
| SMILES | CCOc1cc(OCC)cc(C(=O)Nc2ccc(F)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C17H17FN2O5/c1-3-24-13-7-11(8-14(10-13)25-4-2)17(21)19-12-5-6-15(18)16(9-12)20(22)23/h5-10H,3-4H2,1-2H3,(H,19,21) |
| InChIKey | VWYSUORUDWNACP-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.33 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|